C16H21N3O2S — CID 1226733
2-(acetylcarbamothioylamino)-N-cyclohexylbenzamide (PubChem CID 1226733) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is 2-(acetylcarbamothioylamino)-N-cyclohexylbenzamide.
| Compound Name | 2-(acetylcarbamothioylamino)-N-cyclohexylbenzamide |
|---|---|
| PubChem CID | 1226733 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 2-(acetylcarbamothioylamino)-N-cyclohexylbenzamide |
| SMILES | CC(=O)NC(=S)Nc1ccccc1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C16H21N3O2S/c1-11(20)17-16(22)19-14-10-6-5-9-13(14)15(21)18-12-7-3-2-4-8-12/h5-6,9-10,12H,2-4,7-8H2,1H3,(H,18,21)(H2,17,19,20,22) |
| InChIKey | PURGNTBPZPRXAE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|