C22H35N3S — CID 92696986
N-(2,4-dimethylphenyl)-4-[methyl-[(1R,2R)-2-methylcyclohexyl]amino]piperidine-1-carbothioamide (PubChem CID 92696986) has the molecular formula C22H35N3S and a molecular weight of 373.61 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-4-[methyl-[(1R,2R)-2-methylcyclohexyl]amino]piperidine-1-carbothioamide.
| Compound Name | N-(2,4-dimethylphenyl)-4-[methyl-[(1R,2R)-2-methylcyclohexyl]amino]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 92696986 |
| Molecular Formula | C22H35N3S |
| Molecular Weight | 373.61 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | N-(2,4-dimethylphenyl)-4-[methyl-[(1R,2R)-2-methylcyclohexyl]amino]piperidine-1-carbothioamide |
| SMILES | Cc1ccc(NC(=S)N2CCC(N(C)[C@@H]3CCCC[C@H]3C)CC2)c(C)c1 |
| InChI | InChI=1S/C22H35N3S/c1-16-9-10-20(18(3)15-16)23-22(26)25-13-11-19(12-14-25)24(4)21-8-6-5-7-17(21)2/h9-10,15,17,19,21H,5-8,11-14H2,1-4H3,(H,23,26)/t17-,21-/m1/s1 |
| InChIKey | YYOPNVHKWFFAIH-DYESRHJHSA-N |
| XLogP | 4.98 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.61 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|