C19H22F3N5S — CID 2796046
N-(2,4-dimethylphenyl)-4-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]piperidine-1-carbothioamide (PubChem CID 2796046) has the molecular formula C19H22F3N5S and a molecular weight of 409.48 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-4-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]piperidine-1-carbothioamide.
| Compound Name | N-(2,4-dimethylphenyl)-4-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 2796046 |
| Molecular Formula | C19H22F3N5S |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | N-(2,4-dimethylphenyl)-4-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]piperidine-1-carbothioamide |
| SMILES | Cc1ccc(NC(=S)N2CCC(Nc3nccc(C(F)(F)F)n3)CC2)c(C)c1 |
| InChI | InChI=1S/C19H22F3N5S/c1-12-3-4-15(13(2)11-12)25-18(28)27-9-6-14(7-10-27)24-17-23-8-5-16(26-17)19(20,21)22/h3-5,8,11,14H,6-7,9-10H2,1-2H3,(H,25,28)(H,23,24,26) |
| InChIKey | XVTOOSALLOOFFQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|