C14H13F9N4O2 — CID 89480837
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]piperidine-1-carboxylate (PubChem CID 89480837) has the molecular formula C14H13F9N4O2 and a molecular weight of 440.27 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]piperidine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 89480837 |
| Molecular Formula | C14H13F9N4O2 |
| Molecular Weight | 440.27 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]piperidine-1-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCC(Nc2nccc(C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C14H13F9N4O2/c15-12(16,17)8-1-4-24-10(26-8)25-7-2-5-27(6-3-7)11(28)29-9(13(18,19)20)14(21,22)23/h1,4,7,9H,2-3,5-6H2,(H,24,25,26) |
| InChIKey | PUPZNHVEMBTTCY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.27 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |