C10H12F3N3O2S — CID 64584316
N-(1,1-dioxothian-4-yl)-4-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 64584316) has the molecular formula C10H12F3N3O2S and a molecular weight of 295.29 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-4-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-(1,1-dioxothian-4-yl)-4-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 64584316 |
| Molecular Formula | C10H12F3N3O2S |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-4-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | O=S1(=O)CCC(Nc2nccc(C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C10H12F3N3O2S/c11-10(12,13)8-1-4-14-9(16-8)15-7-2-5-19(17,18)6-3-7/h1,4,7H,2-3,5-6H2,(H,14,15,16) |
| InChIKey | IBPHNRBZDYGRHN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |