C10H11F3N4O2 — CID 133385767
methyl 3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]azetidine-1-carboxylate (PubChem CID 133385767) has the molecular formula C10H11F3N4O2 and a molecular weight of 276.22 g/mol. Its IUPAC name is methyl 3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]azetidine-1-carboxylate.
| Compound Name | methyl 3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 133385767 |
| Molecular Formula | C10H11F3N4O2 |
| Molecular Weight | 276.22 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | methyl 3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]azetidine-1-carboxylate |
| SMILES | COC(=O)N1CC(Nc2nccc(C(F)(F)F)n2)C1 |
| InChI | InChI=1S/C10H11F3N4O2/c1-19-9(18)17-4-6(5-17)15-8-14-3-2-7(16-8)10(11,12)13/h2-3,6H,4-5H2,1H3,(H,14,15,16) |
| InChIKey | LMTLNRNBNALOJF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.22 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |