C16H23F3N4O2 — CID 133496079
tert-butyl 4-methyl-3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]piperidine-1-carboxylate (PubChem CID 133496079) has the molecular formula C16H23F3N4O2 and a molecular weight of 360.38 g/mol. Its IUPAC name is tert-butyl 4-methyl-3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-methyl-3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 133496079 |
| Molecular Formula | C16H23F3N4O2 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | tert-butyl 4-methyl-3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]piperidine-1-carboxylate |
| SMILES | CC1CCN(C(=O)OC(C)(C)C)CC1Nc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C16H23F3N4O2/c1-10-6-8-23(14(24)25-15(2,3)4)9-11(10)21-13-20-7-5-12(22-13)16(17,18)19/h5,7,10-11H,6,8-9H2,1-4H3,(H,20,21,22) |
| InChIKey | MXONVDPMZOYNRM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |