C18H22F3N3O2 — CID 18187575
tert-butyl 4-[3-[4-(trifluoromethyl)pyrimidin-2-yl]prop-2-ynyl]piperidine-1-carboxylate (PubChem CID 18187575) has the molecular formula C18H22F3N3O2 and a molecular weight of 369.39 g/mol. Its IUPAC name is tert-butyl 4-[3-[4-(trifluoromethyl)pyrimidin-2-yl]prop-2-ynyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[4-(trifluoromethyl)pyrimidin-2-yl]prop-2-ynyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 18187575 |
| Molecular Formula | C18H22F3N3O2 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | tert-butyl 4-[3-[4-(trifluoromethyl)pyrimidin-2-yl]prop-2-ynyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC#Cc2nccc(C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C18H22F3N3O2/c1-17(2,3)26-16(25)24-11-8-13(9-12-24)5-4-6-15-22-10-7-14(23-15)18(19,20)21/h7,10,13H,5,8-9,11-12H2,1-3H3 |
| InChIKey | YCFGTTZOSCCLKP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|