C19H32N2O2 — CID 123647865
tert-butyl 4-ethylpiperidine-1-carboxylate;4-ethylpyridine (PubChem CID 123647865) has the molecular formula C19H32N2O2 and a molecular weight of 320.48 g/mol. Its IUPAC name is tert-butyl 4-ethylpiperidine-1-carboxylate;4-ethylpyridine.
| Compound Name | tert-butyl 4-ethylpiperidine-1-carboxylate;4-ethylpyridine |
|---|---|
| PubChem CID | 123647865 |
| Molecular Formula | C19H32N2O2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | tert-butyl 4-ethylpiperidine-1-carboxylate;4-ethylpyridine |
| SMILES | CCC1CCN(C(=O)OC(C)(C)C)CC1.CCc1ccncc1 |
| InChI | InChI=1S/C12H23NO2.C7H9N/c1-5-10-6-8-13(9-7-10)11(14)15-12(2,3)4;1-2-7-3-5-8-6-4-7/h10H,5-9H2,1-4H3;3-6H,2H2,1H3 |
| InChIKey | RXEJLVKMOZOQDB-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |