C14H14BrF6N3O2 — CID 89480970
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(6-bromo-2-pyridinyl)amino]piperidine-1-carboxylate (PubChem CID 89480970) has the molecular formula C14H14BrF6N3O2 and a molecular weight of 450.18 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(6-bromo-2-pyridinyl)amino]piperidine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(6-bromo-2-pyridinyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 89480970 |
| Molecular Formula | C14H14BrF6N3O2 |
| Molecular Weight | 450.18 g/mol |
| Exact Mass | 449.02 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(6-bromo-2-pyridinyl)amino]piperidine-1-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCC(Nc2cccc(Br)n2)CC1 |
| InChI | InChI=1S/C14H14BrF6N3O2/c15-9-2-1-3-10(23-9)22-8-4-6-24(7-5-8)12(25)26-11(13(16,17)18)14(19,20)21/h1-3,8,11H,4-7H2,(H,22,23) |
| InChIKey | OMBBJCRDTXXANK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.18 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|