C11H14FN3O2 — CID 71996052
methyl 3-[(6-fluoro-2-pyridinyl)amino]pyrrolidine-1-carboxylate (PubChem CID 71996052) has the molecular formula C11H14FN3O2 and a molecular weight of 239.25 g/mol. Its IUPAC name is methyl 3-[(6-fluoro-2-pyridinyl)amino]pyrrolidine-1-carboxylate.
| Compound Name | methyl 3-[(6-fluoro-2-pyridinyl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71996052 |
| Molecular Formula | C11H14FN3O2 |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | methyl 3-[(6-fluoro-2-pyridinyl)amino]pyrrolidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(Nc2cccc(F)n2)C1 |
| InChI | InChI=1S/C11H14FN3O2/c1-17-11(16)15-6-5-8(7-15)13-10-4-2-3-9(12)14-10/h2-4,8H,5-7H2,1H3,(H,13,14) |
| InChIKey | VOGYKVDDNWRHLT-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|