C13H16F3N3O2 — CID 133273523
methyl 4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidine-1-carboxylate (PubChem CID 133273523) has the molecular formula C13H16F3N3O2 and a molecular weight of 303.28 g/mol. Its IUPAC name is methyl 4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidine-1-carboxylate.
| Compound Name | methyl 4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 133273523 |
| Molecular Formula | C13H16F3N3O2 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | methyl 4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(Nc2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C13H16F3N3O2/c1-21-12(20)19-6-4-10(5-7-19)18-11-3-2-9(8-17-11)13(14,15)16/h2-3,8,10H,4-7H2,1H3,(H,17,18) |
| InChIKey | IJVJVKDIHVMJCU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |