C28H36F3N5O — CID 58577071
4-[5-(4-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-[4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-1-yl]butan-1-one (PubChem CID 58577071) has the molecular formula C28H36F3N5O and a molecular weight of 515.62 g/mol. Its IUPAC name is 4-[5-(4-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-[4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-1-yl]butan-1-one.
| Compound Name | 4-[5-(4-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-[4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 58577071 |
| Molecular Formula | C28H36F3N5O |
| Molecular Weight | 515.62 g/mol |
| Exact Mass | 515.29 |
| IUPAC Name | 4-[5-(4-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-[4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-1-yl]butan-1-one |
| SMILES | Cc1ccc(N2CC3CN(CCCC(=O)N4CCC(Nc5ccc(C(F)(F)F)cn5)CC4)CC3C2)cc1 |
| InChI | InChI=1S/C28H36F3N5O/c1-20-4-7-25(8-5-20)36-18-21-16-34(17-22(21)19-36)12-2-3-27(37)35-13-10-24(11-14-35)33-26-9-6-23(15-32-26)28(29,30)31/h4-9,15,21-22,24H,2-3,10-14,16-19H2,1H3,(H,32,33) |
| InChIKey | YHKIQYDAETYTAQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.62 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|