C28H35F3N4OS — CID 58576887
3-[5-(4-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-[4-[4-(trifluoromethylsulfanyl)anilino]piperidin-1-yl]propan-1-one (PubChem CID 58576887) has the molecular formula C28H35F3N4OS and a molecular weight of 532.68 g/mol. Its IUPAC name is 3-[5-(4-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-[4-[4-(trifluoromethylsulfanyl)anilino]piperidin-1-yl]propan-1-one.
| Compound Name | 3-[5-(4-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-[4-[4-(trifluoromethylsulfanyl)anilino]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 58576887 |
| Molecular Formula | C28H35F3N4OS |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | 3-[5-(4-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-[4-[4-(trifluoromethylsulfanyl)anilino]piperidin-1-yl]propan-1-one |
| SMILES | Cc1ccc(N2CC3CN(CCC(=O)N4CCC(Nc5ccc(SC(F)(F)F)cc5)CC4)CC3C2)cc1 |
| InChI | InChI=1S/C28H35F3N4OS/c1-20-2-6-25(7-3-20)35-18-21-16-33(17-22(21)19-35)13-12-27(36)34-14-10-24(11-15-34)32-23-4-8-26(9-5-23)37-28(29,30)31/h2-9,21-22,24,32H,10-19H2,1H3 |
| InChIKey | UTRXJCNRJASMCP-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|