C31H44F3N5O — CID 158603862
3-[5-(4-tert-butylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-[4-[[2-(trifluoromethyl)-4-pyridinyl]amino]piperidin-1-yl]propan-1-one;methane (PubChem CID 158603862) has the molecular formula C31H44F3N5O and a molecular weight of 559.72 g/mol. Its IUPAC name is 3-[5-(4-tert-butylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-[4-[[2-(trifluoromethyl)-4-pyridinyl]amino]piperidin-1-yl]propan-1-one;methane.
| Compound Name | 3-[5-(4-tert-butylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-[4-[[2-(trifluoromethyl)-4-pyridinyl]amino]piperidin-1-yl]propan-1-one;methane |
|---|---|
| PubChem CID | 158603862 |
| Molecular Formula | C31H44F3N5O |
| Molecular Weight | 559.72 g/mol |
| Exact Mass | 559.35 |
| IUPAC Name | 3-[5-(4-tert-butylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-[4-[[2-(trifluoromethyl)-4-pyridinyl]amino]piperidin-1-yl]propan-1-one;methane |
| SMILES | C.CC(C)(C)c1ccc(N2CC3CN(CCC(=O)N4CCC(Nc5ccnc(C(F)(F)F)c5)CC4)CC3C2)cc1 |
| InChI | InChI=1S/C30H40F3N5O.CH4/c1-29(2,3)23-4-6-26(7-5-23)38-19-21-17-36(18-22(21)20-38)13-11-28(39)37-14-9-24(10-15-37)35-25-8-12-34-27(16-25)30(31,32)33;/h4-8,12,16,21-22,24H,9-11,13-15,17-20H2,1-3H3,(H,34,35);1H4 |
| InChIKey | HVYWTEHSZLMIEX-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.72 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |