C29H41F3IN5O — CID 90377290
4-[3-(4-tert-butylanilino)propyl-(iodomethyl)amino]-1-[4-[[2-(trifluoromethyl)-4-pyridinyl]amino]piperidin-1-yl]butan-1-one (PubChem CID 90377290) has the molecular formula C29H41F3IN5O and a molecular weight of 659.58 g/mol. Its IUPAC name is 4-[3-(4-tert-butylanilino)propyl-(iodomethyl)amino]-1-[4-[[2-(trifluoromethyl)-4-pyridinyl]amino]piperidin-1-yl]butan-1-one.
| Compound Name | 4-[3-(4-tert-butylanilino)propyl-(iodomethyl)amino]-1-[4-[[2-(trifluoromethyl)-4-pyridinyl]amino]piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 90377290 |
| Molecular Formula | C29H41F3IN5O |
| Molecular Weight | 659.58 g/mol |
| Exact Mass | 659.23 |
| IUPAC Name | 4-[3-(4-tert-butylanilino)propyl-(iodomethyl)amino]-1-[4-[[2-(trifluoromethyl)-4-pyridinyl]amino]piperidin-1-yl]butan-1-one |
| SMILES | CC(C)(C)c1ccc(NCCCN(CI)CCCC(=O)N2CCC(Nc3ccnc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C29H41F3IN5O/c1-28(2,3)22-7-9-23(10-8-22)34-14-5-17-37(21-33)16-4-6-27(39)38-18-12-24(13-19-38)36-25-11-15-35-26(20-25)29(30,31)32/h7-11,15,20,24,34H,4-6,12-14,16-19,21H2,1-3H3,(H,35,36) |
| InChIKey | HRSQBOFSMYHGSZ-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.58 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|