C30H40F3N3OS — CID 162165241
methane;3-[5-(4-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-[(3R)-3-[[4-(trifluoromethylsulfanyl)phenyl]methyl]piperidin-1-yl]propan-1-one (PubChem CID 162165241) has the molecular formula C30H40F3N3OS and a molecular weight of 547.73 g/mol. Its IUPAC name is methane;3-[5-(4-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-[(3R)-3-[[4-(trifluoromethylsulfanyl)phenyl]methyl]piperidin-1-yl]propan-1-one.
| Compound Name | methane;3-[5-(4-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-[(3R)-3-[[4-(trifluoromethylsulfanyl)phenyl]methyl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 162165241 |
| Molecular Formula | C30H40F3N3OS |
| Molecular Weight | 547.73 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | methane;3-[5-(4-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-[(3R)-3-[[4-(trifluoromethylsulfanyl)phenyl]methyl]piperidin-1-yl]propan-1-one |
| SMILES | C.Cc1ccc(N2CC3CN(CCC(=O)N4CCC[C@H](Cc5ccc(SC(F)(F)F)cc5)C4)CC3C2)cc1 |
| InChI | InChI=1S/C29H36F3N3OS.CH4/c1-21-4-8-26(9-5-21)35-19-24-17-33(18-25(24)20-35)14-12-28(36)34-13-2-3-23(16-34)15-22-6-10-27(11-7-22)37-29(30,31)32;/h4-11,23-25H,2-3,12-20H2,1H3;1H4/t23-,24?,25?;/m1./s1 |
| InChIKey | ZNAOLUNZWBBASQ-UGMYRCGCSA-N |
| XLogP | 6.48 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.73 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|