C25H32F3N5O — CID 70845384
3-[4-(4-methylphenyl)piperazin-1-yl]-1-[3-[[5-(trifluoromethyl)-3-pyridinyl]amino]piperidin-1-yl]propan-1-one (PubChem CID 70845384) has the molecular formula C25H32F3N5O and a molecular weight of 475.56 g/mol. Its IUPAC name is 3-[4-(4-methylphenyl)piperazin-1-yl]-1-[3-[[5-(trifluoromethyl)-3-pyridinyl]amino]piperidin-1-yl]propan-1-one.
| Compound Name | 3-[4-(4-methylphenyl)piperazin-1-yl]-1-[3-[[5-(trifluoromethyl)-3-pyridinyl]amino]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 70845384 |
| Molecular Formula | C25H32F3N5O |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | 3-[4-(4-methylphenyl)piperazin-1-yl]-1-[3-[[5-(trifluoromethyl)-3-pyridinyl]amino]piperidin-1-yl]propan-1-one |
| SMILES | Cc1ccc(N2CCN(CCC(=O)N3CCCC(Nc4cncc(C(F)(F)F)c4)C3)CC2)cc1 |
| InChI | InChI=1S/C25H32F3N5O/c1-19-4-6-23(7-5-19)32-13-11-31(12-14-32)10-8-24(34)33-9-2-3-21(18-33)30-22-15-20(16-29-17-22)25(26,27)28/h4-7,15-17,21,30H,2-3,8-14,18H2,1H3 |
| InChIKey | WRFBSWNPLKEUII-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|