C29H36F3N5O — CID 58576532
4-[[1-[4-[4-(4-methylphenyl)-1,4-diazepan-1-yl]butanoyl]piperidin-4-yl]amino]-2-(trifluoromethyl)benzonitrile (PubChem CID 58576532) has the molecular formula C29H36F3N5O and a molecular weight of 527.64 g/mol. Its IUPAC name is 4-[[1-[4-[4-(4-methylphenyl)-1,4-diazepan-1-yl]butanoyl]piperidin-4-yl]amino]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[[1-[4-[4-(4-methylphenyl)-1,4-diazepan-1-yl]butanoyl]piperidin-4-yl]amino]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 58576532 |
| Molecular Formula | C29H36F3N5O |
| Molecular Weight | 527.64 g/mol |
| Exact Mass | 527.29 |
| IUPAC Name | 4-[[1-[4-[4-(4-methylphenyl)-1,4-diazepan-1-yl]butanoyl]piperidin-4-yl]amino]-2-(trifluoromethyl)benzonitrile |
| SMILES | Cc1ccc(N2CCCN(CCCC(=O)N3CCC(Nc4ccc(C#N)c(C(F)(F)F)c4)CC3)CC2)cc1 |
| InChI | InChI=1S/C29H36F3N5O/c1-22-5-9-26(10-6-22)36-15-3-14-35(18-19-36)13-2-4-28(38)37-16-11-24(12-17-37)34-25-8-7-23(21-33)27(20-25)29(30,31)32/h5-10,20,24,34H,2-4,11-19H2,1H3 |
| InChIKey | OJWOWPSNASRPNE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 62.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.64 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|