C28H34F3N5S — CID 89025332
N-[1-[4-cyano-3-(trifluoromethyl)phenyl]piperidin-4-yl]-4-[4-(4-methylphenyl)piperazin-1-yl]butanethioamide (PubChem CID 89025332) has the molecular formula C28H34F3N5S and a molecular weight of 529.68 g/mol. Its IUPAC name is N-[1-[4-cyano-3-(trifluoromethyl)phenyl]piperidin-4-yl]-4-[4-(4-methylphenyl)piperazin-1-yl]butanethioamide.
| Compound Name | N-[1-[4-cyano-3-(trifluoromethyl)phenyl]piperidin-4-yl]-4-[4-(4-methylphenyl)piperazin-1-yl]butanethioamide |
|---|---|
| PubChem CID | 89025332 |
| Molecular Formula | C28H34F3N5S |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | N-[1-[4-cyano-3-(trifluoromethyl)phenyl]piperidin-4-yl]-4-[4-(4-methylphenyl)piperazin-1-yl]butanethioamide |
| SMILES | Cc1ccc(N2CCN(CCCC(=S)NC3CCN(c4ccc(C#N)c(C(F)(F)F)c4)CC3)CC2)cc1 |
| InChI | InChI=1S/C28H34F3N5S/c1-21-4-7-24(8-5-21)36-17-15-34(16-18-36)12-2-3-27(37)33-23-10-13-35(14-11-23)25-9-6-22(20-32)26(19-25)28(29,30)31/h4-9,19,23H,2-3,10-18H2,1H3,(H,33,37) |
| InChIKey | OIJHMVZOVUEVHU-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 45.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|