C27H35ClF3N5O3 — CID 157451214
4-[4-(4-chlorophenyl)piperazin-1-yl]-N-[1-[4-nitro-3-(trifluoromethyl)phenyl]piperidin-4-yl]butanamide;methane (PubChem CID 157451214) has the molecular formula C27H35ClF3N5O3 and a molecular weight of 570.06 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)piperazin-1-yl]-N-[1-[4-nitro-3-(trifluoromethyl)phenyl]piperidin-4-yl]butanamide;methane.
| Compound Name | 4-[4-(4-chlorophenyl)piperazin-1-yl]-N-[1-[4-nitro-3-(trifluoromethyl)phenyl]piperidin-4-yl]butanamide;methane |
|---|---|
| PubChem CID | 157451214 |
| Molecular Formula | C27H35ClF3N5O3 |
| Molecular Weight | 570.06 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | 4-[4-(4-chlorophenyl)piperazin-1-yl]-N-[1-[4-nitro-3-(trifluoromethyl)phenyl]piperidin-4-yl]butanamide;methane |
| SMILES | C.O=C(CCCN1CCN(c2ccc(Cl)cc2)CC1)NC1CCN(c2ccc([N+](=O)[O-])c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C26H31ClF3N5O3.CH4/c27-19-3-5-21(6-4-19)34-16-14-32(15-17-34)11-1-2-25(36)31-20-9-12-33(13-10-20)22-7-8-24(35(37)38)23(18-22)26(28,29)30;/h3-8,18,20H,1-2,9-17H2,(H,31,36);1H4 |
| InChIKey | BSVBZDBXMATYAT-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 81.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.06 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|