C27H31F6N5O2S — CID 88872994
N-[1-[4-nitro-3-(trifluoromethyl)phenyl]piperidin-4-yl]-4-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]butanethioamide (PubChem CID 88872994) has the molecular formula C27H31F6N5O2S and a molecular weight of 603.63 g/mol. Its IUPAC name is N-[1-[4-nitro-3-(trifluoromethyl)phenyl]piperidin-4-yl]-4-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]butanethioamide.
| Compound Name | N-[1-[4-nitro-3-(trifluoromethyl)phenyl]piperidin-4-yl]-4-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]butanethioamide |
|---|---|
| PubChem CID | 88872994 |
| Molecular Formula | C27H31F6N5O2S |
| Molecular Weight | 603.63 g/mol |
| Exact Mass | 603.21 |
| IUPAC Name | N-[1-[4-nitro-3-(trifluoromethyl)phenyl]piperidin-4-yl]-4-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]butanethioamide |
| SMILES | O=[N+]([O-])c1ccc(N2CCC(NC(=S)CCCN3CCN(c4ccc(C(F)(F)F)cc4)CC3)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C27H31F6N5O2S/c28-26(29,30)19-3-5-21(6-4-19)37-16-14-35(15-17-37)11-1-2-25(41)34-20-9-12-36(13-10-20)22-7-8-24(38(39)40)23(18-22)27(31,32)33/h3-8,18,20H,1-2,9-17H2,(H,34,41) |
| InChIKey | VZMOETSBPYQAOS-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 64.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.63 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|