C28H38F3N5O3 — CID 157053049
methane;4-[4-(4-methylphenyl)piperazin-1-yl]-1-[4-[4-nitro-3-(trifluoromethyl)phenyl]-1,4-diazepan-1-yl]butan-1-one (PubChem CID 157053049) has the molecular formula C28H38F3N5O3 and a molecular weight of 549.64 g/mol. Its IUPAC name is methane;4-[4-(4-methylphenyl)piperazin-1-yl]-1-[4-[4-nitro-3-(trifluoromethyl)phenyl]-1,4-diazepan-1-yl]butan-1-one.
| Compound Name | methane;4-[4-(4-methylphenyl)piperazin-1-yl]-1-[4-[4-nitro-3-(trifluoromethyl)phenyl]-1,4-diazepan-1-yl]butan-1-one |
|---|---|
| PubChem CID | 157053049 |
| Molecular Formula | C28H38F3N5O3 |
| Molecular Weight | 549.64 g/mol |
| Exact Mass | 549.29 |
| IUPAC Name | methane;4-[4-(4-methylphenyl)piperazin-1-yl]-1-[4-[4-nitro-3-(trifluoromethyl)phenyl]-1,4-diazepan-1-yl]butan-1-one |
| SMILES | C.Cc1ccc(N2CCN(CCCC(=O)N3CCCN(c4ccc([N+](=O)[O-])c(C(F)(F)F)c4)CC3)CC2)cc1 |
| InChI | InChI=1S/C27H34F3N5O3.CH4/c1-21-5-7-22(8-6-21)33-16-14-31(15-17-33)11-2-4-26(36)34-13-3-12-32(18-19-34)23-9-10-25(35(37)38)24(20-23)27(28,29)30;/h5-10,20H,2-4,11-19H2,1H3;1H4 |
| InChIKey | AAKXEYXBXJNQBT-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 73.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.64 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|