C31H41F3N4O3 — CID 58576531
5-[4-(4-tert-butylphenyl)piperazin-1-yl]-1-[1-[4-nitro-3-(trifluoromethyl)phenyl]piperidin-4-yl]pentan-2-one (PubChem CID 58576531) has the molecular formula C31H41F3N4O3 and a molecular weight of 574.69 g/mol. Its IUPAC name is 5-[4-(4-tert-butylphenyl)piperazin-1-yl]-1-[1-[4-nitro-3-(trifluoromethyl)phenyl]piperidin-4-yl]pentan-2-one.
| Compound Name | 5-[4-(4-tert-butylphenyl)piperazin-1-yl]-1-[1-[4-nitro-3-(trifluoromethyl)phenyl]piperidin-4-yl]pentan-2-one |
|---|---|
| PubChem CID | 58576531 |
| Molecular Formula | C31H41F3N4O3 |
| Molecular Weight | 574.69 g/mol |
| Exact Mass | 574.31 |
| IUPAC Name | 5-[4-(4-tert-butylphenyl)piperazin-1-yl]-1-[1-[4-nitro-3-(trifluoromethyl)phenyl]piperidin-4-yl]pentan-2-one |
| SMILES | CC(C)(C)c1ccc(N2CCN(CCCC(=O)CC3CCN(c4ccc([N+](=O)[O-])c(C(F)(F)F)c4)CC3)CC2)cc1 |
| InChI | InChI=1S/C31H41F3N4O3/c1-30(2,3)24-6-8-25(9-7-24)37-19-17-35(18-20-37)14-4-5-27(39)21-23-12-15-36(16-13-23)26-10-11-29(38(40)41)28(22-26)31(32,33)34/h6-11,22-23H,4-5,12-21H2,1-3H3 |
| InChIKey | QRRVZOFUSLSMDU-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 69.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.69 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|