C26H29ClF3N5O3 — CID 58576766
3-[5-(4-chlorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-[(3R)-3-[4-nitro-3-(trifluoromethyl)anilino]pyrrolidin-1-yl]propan-1-one (PubChem CID 58576766) has the molecular formula C26H29ClF3N5O3 and a molecular weight of 552.00 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-[(3R)-3-[4-nitro-3-(trifluoromethyl)anilino]pyrrolidin-1-yl]propan-1-one.
| Compound Name | 3-[5-(4-chlorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-[(3R)-3-[4-nitro-3-(trifluoromethyl)anilino]pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 58576766 |
| Molecular Formula | C26H29ClF3N5O3 |
| Molecular Weight | 552.00 g/mol |
| Exact Mass | 551.19 |
| IUPAC Name | 3-[5-(4-chlorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-[(3R)-3-[4-nitro-3-(trifluoromethyl)anilino]pyrrolidin-1-yl]propan-1-one |
| SMILES | O=C(CCN1CC2CN(c3ccc(Cl)cc3)CC2C1)N1CC[C@@H](Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C26H29ClF3N5O3/c27-19-1-4-22(5-2-19)34-14-17-12-32(13-18(17)15-34)9-8-25(36)33-10-7-21(16-33)31-20-3-6-24(35(37)38)23(11-20)26(28,29)30/h1-6,11,17-18,21,31H,7-10,12-16H2/t17?,18?,21-/m1/s1 |
| InChIKey | FBSDBCDOPHHRAY-WIXQSORDSA-N |
| XLogP | 4.74 |
| TPSA | 81.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.00 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|