C22H28F3N7O3S — CID 58576429
4-[4-(5-methyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]-1-[(3R)-3-[4-nitro-3-(trifluoromethyl)anilino]pyrrolidin-1-yl]butan-1-one (PubChem CID 58576429) has the molecular formula C22H28F3N7O3S and a molecular weight of 527.57 g/mol. Its IUPAC name is 4-[4-(5-methyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]-1-[(3R)-3-[4-nitro-3-(trifluoromethyl)anilino]pyrrolidin-1-yl]butan-1-one.
| Compound Name | 4-[4-(5-methyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]-1-[(3R)-3-[4-nitro-3-(trifluoromethyl)anilino]pyrrolidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 58576429 |
| Molecular Formula | C22H28F3N7O3S |
| Molecular Weight | 527.57 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | 4-[4-(5-methyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]-1-[(3R)-3-[4-nitro-3-(trifluoromethyl)anilino]pyrrolidin-1-yl]butan-1-one |
| SMILES | Cc1nnc(N2CCN(CCCC(=O)N3CC[C@@H](Nc4ccc([N+](=O)[O-])c(C(F)(F)F)c4)C3)CC2)s1 |
| InChI | InChI=1S/C22H28F3N7O3S/c1-15-27-28-21(36-15)30-11-9-29(10-12-30)7-2-3-20(33)31-8-6-17(14-31)26-16-4-5-19(32(34)35)18(13-16)22(23,24)25/h4-5,13,17,26H,2-3,6-12,14H2,1H3/t17-/m1/s1 |
| InChIKey | FVTUUDWOOYKNMG-QGZVFWFLSA-N |
| XLogP | 3.39 |
| TPSA | 107.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.57 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|