C30H36F3N3O — CID 130211433
1-[4-[4-ethynyl-3-(trifluoromethyl)anilino]piperidin-1-yl]-4-[1-(4-methylphenyl)piperidin-4-yl]butan-1-one (PubChem CID 130211433) has the molecular formula C30H36F3N3O and a molecular weight of 511.63 g/mol. Its IUPAC name is 1-[4-[4-ethynyl-3-(trifluoromethyl)anilino]piperidin-1-yl]-4-[1-(4-methylphenyl)piperidin-4-yl]butan-1-one.
| Compound Name | 1-[4-[4-ethynyl-3-(trifluoromethyl)anilino]piperidin-1-yl]-4-[1-(4-methylphenyl)piperidin-4-yl]butan-1-one |
|---|---|
| PubChem CID | 130211433 |
| Molecular Formula | C30H36F3N3O |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.28 |
| IUPAC Name | 1-[4-[4-ethynyl-3-(trifluoromethyl)anilino]piperidin-1-yl]-4-[1-(4-methylphenyl)piperidin-4-yl]butan-1-one |
| SMILES | C#Cc1ccc(NC2CCN(C(=O)CCCC3CCN(c4ccc(C)cc4)CC3)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C30H36F3N3O/c1-3-24-9-10-26(21-28(24)30(31,32)33)34-25-15-19-36(20-16-25)29(37)6-4-5-23-13-17-35(18-14-23)27-11-7-22(2)8-12-27/h1,7-12,21,23,25,34H,4-6,13-20H2,2H3 |
| InChIKey | XMGHPUAQZAAGDS-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|