C26H31ClF3N3O2 — CID 58118347
2-[4-[4-chloro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-(4-methylphenyl)piperazin-1-yl]ethanone (PubChem CID 58118347) has the molecular formula C26H31ClF3N3O2 and a molecular weight of 510.00 g/mol. Its IUPAC name is 2-[4-[4-chloro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-(4-methylphenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[4-[4-chloro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-(4-methylphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 58118347 |
| Molecular Formula | C26H31ClF3N3O2 |
| Molecular Weight | 510.00 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | 2-[4-[4-chloro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-(4-methylphenyl)piperazin-1-yl]ethanone |
| SMILES | Cc1ccc(N2CCN(C(=O)COC3CCC(Nc4ccc(Cl)c(C(F)(F)F)c4)CC3)CC2)cc1 |
| InChI | InChI=1S/C26H31ClF3N3O2/c1-18-2-7-21(8-3-18)32-12-14-33(15-13-32)25(34)17-35-22-9-4-19(5-10-22)31-20-6-11-24(27)23(16-20)26(28,29)30/h2-3,6-8,11,16,19,22,31H,4-5,9-10,12-15,17H2,1H3 |
| InChIKey | SUMSCYVBFDIGRA-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.00 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|