C27H37N3O2 — CID 58118449
2-[4-(3,4-dimethylanilino)cyclohexyl]oxy-1-[4-(4-methylphenyl)piperazin-1-yl]ethanone (PubChem CID 58118449) has the molecular formula C27H37N3O2 and a molecular weight of 435.61 g/mol. Its IUPAC name is 2-[4-(3,4-dimethylanilino)cyclohexyl]oxy-1-[4-(4-methylphenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[4-(3,4-dimethylanilino)cyclohexyl]oxy-1-[4-(4-methylphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 58118449 |
| Molecular Formula | C27H37N3O2 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.29 |
| IUPAC Name | 2-[4-(3,4-dimethylanilino)cyclohexyl]oxy-1-[4-(4-methylphenyl)piperazin-1-yl]ethanone |
| SMILES | Cc1ccc(N2CCN(C(=O)COC3CCC(Nc4ccc(C)c(C)c4)CC3)CC2)cc1 |
| InChI | InChI=1S/C27H37N3O2/c1-20-4-10-25(11-5-20)29-14-16-30(17-15-29)27(31)19-32-26-12-8-23(9-13-26)28-24-7-6-21(2)22(3)18-24/h4-7,10-11,18,23,26,28H,8-9,12-17,19H2,1-3H3 |
| InChIKey | UXIHGBWYKSDXOY-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|