C28H33ClF3N3O2 — CID 58118251
1-[2-(4-chlorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-[4-[4-methyl-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone (PubChem CID 58118251) has the molecular formula C28H33ClF3N3O2 and a molecular weight of 536.04 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-[4-[4-methyl-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone.
| Compound Name | 1-[2-(4-chlorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-[4-[4-methyl-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone |
|---|---|
| PubChem CID | 58118251 |
| Molecular Formula | C28H33ClF3N3O2 |
| Molecular Weight | 536.04 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-[4-[4-methyl-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone |
| SMILES | Cc1ccc(NC2CCC(OCC(=O)N3CC4CN(c5ccc(Cl)cc5)CC4C3)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C28H33ClF3N3O2/c1-18-2-5-23(12-26(18)28(30,31)32)33-22-6-10-25(11-7-22)37-17-27(36)35-15-19-13-34(14-20(19)16-35)24-8-3-21(29)4-9-24/h2-5,8-9,12,19-20,22,25,33H,6-7,10-11,13-17H2,1H3 |
| InChIKey | WKDNDCHREWZQQQ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.04 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |