C24H29F3N4O4 — CID 88983759
2-[(3R)-3-[4-(dihydroxyamino)-3-(trifluoromethyl)anilino]cyclopentyl]oxy-1-(4-phenylpiperazin-1-yl)ethanone (PubChem CID 88983759) has the molecular formula C24H29F3N4O4 and a molecular weight of 494.51 g/mol. Its IUPAC name is 2-[(3R)-3-[4-(dihydroxyamino)-3-(trifluoromethyl)anilino]cyclopentyl]oxy-1-(4-phenylpiperazin-1-yl)ethanone.
| Compound Name | 2-[(3R)-3-[4-(dihydroxyamino)-3-(trifluoromethyl)anilino]cyclopentyl]oxy-1-(4-phenylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 88983759 |
| Molecular Formula | C24H29F3N4O4 |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | 2-[(3R)-3-[4-(dihydroxyamino)-3-(trifluoromethyl)anilino]cyclopentyl]oxy-1-(4-phenylpiperazin-1-yl)ethanone |
| SMILES | O=C(COC1CC[C@@H](Nc2ccc(N(O)O)c(C(F)(F)F)c2)C1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H29F3N4O4/c25-24(26,27)21-15-18(7-9-22(21)31(33)34)28-17-6-8-20(14-17)35-16-23(32)30-12-10-29(11-13-30)19-4-2-1-3-5-19/h1-5,7,9,15,17,20,28,33-34H,6,8,10-14,16H2/t17-,20?/m1/s1 |
| InChIKey | DPVZDRYRFRFVGJ-DIAVIDTQSA-N |
| XLogP | 3.99 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|