C27H35F3N4O2 — CID 143820553
2-[4-[4-amino-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-(2-ethylphenyl)piperazin-1-yl]ethanone (PubChem CID 143820553) has the molecular formula C27H35F3N4O2 and a molecular weight of 504.60 g/mol. Its IUPAC name is 2-[4-[4-amino-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-(2-ethylphenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[4-[4-amino-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-(2-ethylphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 143820553 |
| Molecular Formula | C27H35F3N4O2 |
| Molecular Weight | 504.60 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | 2-[4-[4-amino-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-(2-ethylphenyl)piperazin-1-yl]ethanone |
| SMILES | CCc1ccccc1N1CCN(C(=O)COC2CCC(Nc3ccc(N)c(C(F)(F)F)c3)CC2)CC1 |
| InChI | InChI=1S/C27H35F3N4O2/c1-2-19-5-3-4-6-25(19)33-13-15-34(16-14-33)26(35)18-36-22-10-7-20(8-11-22)32-21-9-12-24(31)23(17-21)27(28,29)30/h3-6,9,12,17,20,22,32H,2,7-8,10-11,13-16,18,31H2,1H3 |
| InChIKey | AZEQYZZRPIGDIQ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.60 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|