C23H27F3N4O2 — CID 143820567
2-[3-[4-amino-3-(trifluoromethyl)anilino]cyclobutyl]oxy-1-(4-phenylpiperazin-1-yl)ethanone (PubChem CID 143820567) has the molecular formula C23H27F3N4O2 and a molecular weight of 448.49 g/mol. Its IUPAC name is 2-[3-[4-amino-3-(trifluoromethyl)anilino]cyclobutyl]oxy-1-(4-phenylpiperazin-1-yl)ethanone.
| Compound Name | 2-[3-[4-amino-3-(trifluoromethyl)anilino]cyclobutyl]oxy-1-(4-phenylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 143820567 |
| Molecular Formula | C23H27F3N4O2 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 2-[3-[4-amino-3-(trifluoromethyl)anilino]cyclobutyl]oxy-1-(4-phenylpiperazin-1-yl)ethanone |
| SMILES | Nc1ccc(NC2CC(OCC(=O)N3CCN(c4ccccc4)CC3)C2)cc1C(F)(F)F |
| InChI | InChI=1S/C23H27F3N4O2/c24-23(25,26)20-14-16(6-7-21(20)27)28-17-12-19(13-17)32-15-22(31)30-10-8-29(9-11-30)18-4-2-1-3-5-18/h1-7,14,17,19,28H,8-13,15,27H2 |
| InChIKey | FECSGRUZAUNUJJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|