C28H35F3N4O2 — CID 143820457
2-[(1S,4S)-4-[4-amino-3-(trifluoromethyl)anilino]cyclopent-2-en-1-yl]oxy-1-[4-(4-tert-butylphenyl)piperazin-1-yl]ethanone (PubChem CID 143820457) has the molecular formula C28H35F3N4O2 and a molecular weight of 516.61 g/mol. Its IUPAC name is 2-[(1S,4S)-4-[4-amino-3-(trifluoromethyl)anilino]cyclopent-2-en-1-yl]oxy-1-[4-(4-tert-butylphenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[(1S,4S)-4-[4-amino-3-(trifluoromethyl)anilino]cyclopent-2-en-1-yl]oxy-1-[4-(4-tert-butylphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 143820457 |
| Molecular Formula | C28H35F3N4O2 |
| Molecular Weight | 516.61 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | 2-[(1S,4S)-4-[4-amino-3-(trifluoromethyl)anilino]cyclopent-2-en-1-yl]oxy-1-[4-(4-tert-butylphenyl)piperazin-1-yl]ethanone |
| SMILES | CC(C)(C)c1ccc(N2CCN(C(=O)CO[C@@H]3C=C[C@@H](Nc4ccc(N)c(C(F)(F)F)c4)C3)CC2)cc1 |
| InChI | InChI=1S/C28H35F3N4O2/c1-27(2,3)19-4-8-22(9-5-19)34-12-14-35(15-13-34)26(36)18-37-23-10-6-20(16-23)33-21-7-11-25(32)24(17-21)28(29,30)31/h4-11,17,20,23,33H,12-16,18,32H2,1-3H3/t20-,23-/m1/s1 |
| InChIKey | KUAURHSLSKQPFJ-NFBKMPQASA-N |
| XLogP | 5.06 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.61 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|