C28H37F3N4O2 — CID 143820588
2-[4-[4-amino-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-(4-methylphenyl)piperazin-1-yl]butan-1-one (PubChem CID 143820588) has the molecular formula C28H37F3N4O2 and a molecular weight of 518.62 g/mol. Its IUPAC name is 2-[4-[4-amino-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-(4-methylphenyl)piperazin-1-yl]butan-1-one.
| Compound Name | 2-[4-[4-amino-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-(4-methylphenyl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 143820588 |
| Molecular Formula | C28H37F3N4O2 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | 2-[4-[4-amino-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-(4-methylphenyl)piperazin-1-yl]butan-1-one |
| SMILES | CCC(OC1CCC(Nc2ccc(N)c(C(F)(F)F)c2)CC1)C(=O)N1CCN(c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C28H37F3N4O2/c1-3-26(27(36)35-16-14-34(15-17-35)22-9-4-19(2)5-10-22)37-23-11-6-20(7-12-23)33-21-8-13-25(32)24(18-21)28(29,30)31/h4-5,8-10,13,18,20,23,26,33H,3,6-7,11-12,14-17,32H2,1-2H3 |
| InChIKey | MFVHJSXRPURRCF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|