C29H39F6N5S — CID 144994284
1-[4-[4-amino-3-(trifluoromethyl)anilino]piperidin-1-yl]-4-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]butane-1-thione;ethane (PubChem CID 144994284) has the molecular formula C29H39F6N5S and a molecular weight of 603.72 g/mol. Its IUPAC name is 1-[4-[4-amino-3-(trifluoromethyl)anilino]piperidin-1-yl]-4-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]butane-1-thione;ethane.
| Compound Name | 1-[4-[4-amino-3-(trifluoromethyl)anilino]piperidin-1-yl]-4-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]butane-1-thione;ethane |
|---|---|
| PubChem CID | 144994284 |
| Molecular Formula | C29H39F6N5S |
| Molecular Weight | 603.72 g/mol |
| Exact Mass | 603.28 |
| IUPAC Name | 1-[4-[4-amino-3-(trifluoromethyl)anilino]piperidin-1-yl]-4-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]butane-1-thione;ethane |
| SMILES | CC.Nc1ccc(NC2CCN(C(=S)CCCN3CCN(c4ccc(C(F)(F)F)cc4)CC3)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C27H33F6N5S.C2H6/c28-26(29,30)19-3-6-22(7-4-19)37-16-14-36(15-17-37)11-1-2-25(39)38-12-9-20(10-13-38)35-21-5-8-24(34)23(18-21)27(31,32)33;1-2/h3-8,18,20,35H,1-2,9-17,34H2;1-2H3 |
| InChIKey | WDLZQLCTPYIVQF-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 47.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.72 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|