C26H29ClF3N5S — CID 88872943
2-chloro-4-[[1-[3-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]propanethioyl]piperidin-4-yl]amino]benzonitrile (PubChem CID 88872943) has the molecular formula C26H29ClF3N5S and a molecular weight of 536.07 g/mol. Its IUPAC name is 2-chloro-4-[[1-[3-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]propanethioyl]piperidin-4-yl]amino]benzonitrile.
| Compound Name | 2-chloro-4-[[1-[3-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]propanethioyl]piperidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 88872943 |
| Molecular Formula | C26H29ClF3N5S |
| Molecular Weight | 536.07 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | 2-chloro-4-[[1-[3-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]propanethioyl]piperidin-4-yl]amino]benzonitrile |
| SMILES | N#Cc1ccc(NC2CCN(C(=S)CCN3CCN(c4ccc(C(F)(F)F)cc4)CC3)CC2)cc1Cl |
| InChI | InChI=1S/C26H29ClF3N5S/c27-24-17-22(4-1-19(24)18-31)32-21-7-11-35(12-8-21)25(36)9-10-33-13-15-34(16-14-33)23-5-2-20(3-6-23)26(28,29)30/h1-6,17,21,32H,7-16H2 |
| InChIKey | RQKJHKWGFSTLLF-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 45.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.07 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|