C27H30F6N4O2S — CID 58576696
1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]-3-[4-[4-(trifluoromethyl)phenyl]piperidin-1-yl]propane-1-thione (PubChem CID 58576696) has the molecular formula C27H30F6N4O2S and a molecular weight of 588.62 g/mol. Its IUPAC name is 1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]-3-[4-[4-(trifluoromethyl)phenyl]piperidin-1-yl]propane-1-thione.
| Compound Name | 1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]-3-[4-[4-(trifluoromethyl)phenyl]piperidin-1-yl]propane-1-thione |
|---|---|
| PubChem CID | 58576696 |
| Molecular Formula | C27H30F6N4O2S |
| Molecular Weight | 588.62 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | 1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]-3-[4-[4-(trifluoromethyl)phenyl]piperidin-1-yl]propane-1-thione |
| SMILES | O=[N+]([O-])c1ccc(NC2CCN(C(=S)CCN3CCC(c4ccc(C(F)(F)F)cc4)CC3)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C27H30F6N4O2S/c28-26(29,30)20-3-1-18(2-4-20)19-7-12-35(13-8-19)14-11-25(40)36-15-9-21(10-16-36)34-22-5-6-24(37(38)39)23(17-22)27(31,32)33/h1-6,17,19,21,34H,7-16H2 |
| InChIKey | JJZCRXXEDUDYHY-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 61.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.62 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|