C27H32F3N3O4S — CID 58118406
1-[4-(4-methoxyphenyl)piperidin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanethione (PubChem CID 58118406) has the molecular formula C27H32F3N3O4S and a molecular weight of 551.63 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenyl)piperidin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanethione.
| Compound Name | 1-[4-(4-methoxyphenyl)piperidin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanethione |
|---|---|
| PubChem CID | 58118406 |
| Molecular Formula | C27H32F3N3O4S |
| Molecular Weight | 551.63 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | 1-[4-(4-methoxyphenyl)piperidin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanethione |
| SMILES | COc1ccc(C2CCN(C(=S)COC3CCC(Nc4ccc([N+](=O)[O-])c(C(F)(F)F)c4)CC3)CC2)cc1 |
| InChI | InChI=1S/C27H32F3N3O4S/c1-36-22-7-2-18(3-8-22)19-12-14-32(15-13-19)26(38)17-37-23-9-4-20(5-10-23)31-21-6-11-25(33(34)35)24(16-21)27(28,29)30/h2-3,6-8,11,16,19-20,23,31H,4-5,9-10,12-15,17H2,1H3 |
| InChIKey | UJFWPYNLJYHANR-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.63 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|