C26H29ClF3N3O3S — CID 58118198
1-[4-(4-chlorophenyl)piperidin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanethione (PubChem CID 58118198) has the molecular formula C26H29ClF3N3O3S and a molecular weight of 556.05 g/mol. Its IUPAC name is 1-[4-(4-chlorophenyl)piperidin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanethione.
| Compound Name | 1-[4-(4-chlorophenyl)piperidin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanethione |
|---|---|
| PubChem CID | 58118198 |
| Molecular Formula | C26H29ClF3N3O3S |
| Molecular Weight | 556.05 g/mol |
| Exact Mass | 555.16 |
| IUPAC Name | 1-[4-(4-chlorophenyl)piperidin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanethione |
| SMILES | O=[N+]([O-])c1ccc(NC2CCC(OCC(=S)N3CCC(c4ccc(Cl)cc4)CC3)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C26H29ClF3N3O3S/c27-19-3-1-17(2-4-19)18-11-13-32(14-12-18)25(37)16-36-22-8-5-20(6-9-22)31-21-7-10-24(33(34)35)23(15-21)26(28,29)30/h1-4,7,10,15,18,20,22,31H,5-6,8-9,11-14,16H2 |
| InChIKey | PSIBZLYIHRMTOW-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.05 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|