C26H31ClFN3O2S — CID 88983840
1-[4-(4-chlorophenyl)piperidin-1-yl]-2-[4-[3-(fluoromethyl)-4-nitrosoanilino]cyclohexyl]oxyethanethione (PubChem CID 88983840) has the molecular formula C26H31ClFN3O2S and a molecular weight of 504.07 g/mol. Its IUPAC name is 1-[4-(4-chlorophenyl)piperidin-1-yl]-2-[4-[3-(fluoromethyl)-4-nitrosoanilino]cyclohexyl]oxyethanethione.
| Compound Name | 1-[4-(4-chlorophenyl)piperidin-1-yl]-2-[4-[3-(fluoromethyl)-4-nitrosoanilino]cyclohexyl]oxyethanethione |
|---|---|
| PubChem CID | 88983840 |
| Molecular Formula | C26H31ClFN3O2S |
| Molecular Weight | 504.07 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | 1-[4-(4-chlorophenyl)piperidin-1-yl]-2-[4-[3-(fluoromethyl)-4-nitrosoanilino]cyclohexyl]oxyethanethione |
| SMILES | O=Nc1ccc(NC2CCC(OCC(=S)N3CCC(c4ccc(Cl)cc4)CC3)CC2)cc1CF |
| InChI | InChI=1S/C26H31ClFN3O2S/c27-21-3-1-18(2-4-21)19-11-13-31(14-12-19)26(34)17-33-24-8-5-22(6-9-24)29-23-7-10-25(30-32)20(15-23)16-28/h1-4,7,10,15,19,22,24,29H,5-6,8-9,11-14,16-17H2 |
| InChIKey | RGMJXSYIUDPXAU-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.07 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|