C29H40ClN3OS — CID 58117993
1-[4-(4-tert-butylphenyl)piperazin-1-yl]-2-[4-(4-chloro-3-methylanilino)cyclohexyl]oxyethanethione (PubChem CID 58117993) has the molecular formula C29H40ClN3OS and a molecular weight of 514.18 g/mol. Its IUPAC name is 1-[4-(4-tert-butylphenyl)piperazin-1-yl]-2-[4-(4-chloro-3-methylanilino)cyclohexyl]oxyethanethione.
| Compound Name | 1-[4-(4-tert-butylphenyl)piperazin-1-yl]-2-[4-(4-chloro-3-methylanilino)cyclohexyl]oxyethanethione |
|---|---|
| PubChem CID | 58117993 |
| Molecular Formula | C29H40ClN3OS |
| Molecular Weight | 514.18 g/mol |
| Exact Mass | 513.26 |
| IUPAC Name | 1-[4-(4-tert-butylphenyl)piperazin-1-yl]-2-[4-(4-chloro-3-methylanilino)cyclohexyl]oxyethanethione |
| SMILES | Cc1cc(NC2CCC(OCC(=S)N3CCN(c4ccc(C(C)(C)C)cc4)CC3)CC2)ccc1Cl |
| InChI | InChI=1S/C29H40ClN3OS/c1-21-19-24(9-14-27(21)30)31-23-7-12-26(13-8-23)34-20-28(35)33-17-15-32(16-18-33)25-10-5-22(6-11-25)29(2,3)4/h5-6,9-11,14,19,23,26,31H,7-8,12-13,15-18,20H2,1-4H3 |
| InChIKey | CMFJPDSUSIQEDH-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.18 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|