C27H27F6N5O6 — CID 90150036
2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-[5-(trifluoromethoxy)-1,3-benzoxazol-2-yl]piperazin-1-yl]ethanone (PubChem CID 90150036) has the molecular formula C27H27F6N5O6 and a molecular weight of 631.53 g/mol. Its IUPAC name is 2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-[5-(trifluoromethoxy)-1,3-benzoxazol-2-yl]piperazin-1-yl]ethanone.
| Compound Name | 2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-[5-(trifluoromethoxy)-1,3-benzoxazol-2-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 90150036 |
| Molecular Formula | C27H27F6N5O6 |
| Molecular Weight | 631.53 g/mol |
| Exact Mass | 631.19 |
| IUPAC Name | 2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-[5-(trifluoromethoxy)-1,3-benzoxazol-2-yl]piperazin-1-yl]ethanone |
| SMILES | O=C(COC1CCC(Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)CC1)N1CCN(c2nc3cc(OC(F)(F)F)ccc3o2)CC1 |
| InChI | InChI=1S/C27H27F6N5O6/c28-26(29,30)20-13-17(3-7-22(20)38(40)41)34-16-1-4-18(5-2-16)42-15-24(39)36-9-11-37(12-10-36)25-35-21-14-19(44-27(31,32)33)6-8-23(21)43-25/h3,6-8,13-14,16,18,34H,1-2,4-5,9-12,15H2 |
| InChIKey | YXHKXNOFNRTOCC-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.53 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|