C27H30F3N5O4 — CID 162556951
4-[4-[2-[4-[[4-nitro-3-(trifluoromethyl)anilino]methyl]cyclohexyl]oxyacetyl]piperazin-1-yl]benzonitrile (PubChem CID 162556951) has the molecular formula C27H30F3N5O4 and a molecular weight of 545.56 g/mol. Its IUPAC name is 4-[4-[2-[4-[[4-nitro-3-(trifluoromethyl)anilino]methyl]cyclohexyl]oxyacetyl]piperazin-1-yl]benzonitrile.
| Compound Name | 4-[4-[2-[4-[[4-nitro-3-(trifluoromethyl)anilino]methyl]cyclohexyl]oxyacetyl]piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 162556951 |
| Molecular Formula | C27H30F3N5O4 |
| Molecular Weight | 545.56 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | 4-[4-[2-[4-[[4-nitro-3-(trifluoromethyl)anilino]methyl]cyclohexyl]oxyacetyl]piperazin-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2CCN(C(=O)COC3CCC(CNc4ccc([N+](=O)[O-])c(C(F)(F)F)c4)CC3)CC2)cc1 |
| InChI | InChI=1S/C27H30F3N5O4/c28-27(29,30)24-15-21(5-10-25(24)35(37)38)32-17-20-3-8-23(9-4-20)39-18-26(36)34-13-11-33(12-14-34)22-6-1-19(16-31)2-7-22/h1-2,5-7,10,15,20,23,32H,3-4,8-9,11-14,17-18H2 |
| InChIKey | LXIYPDIZRYBGBM-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 111.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.56 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|