C25H29F3N4O6 — CID 67282779
1-[4-(6-methoxy-3-pyridinyl)piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)phenoxy]cyclohexyl]oxyethanone (PubChem CID 67282779) has the molecular formula C25H29F3N4O6 and a molecular weight of 538.52 g/mol. Its IUPAC name is 1-[4-(6-methoxy-3-pyridinyl)piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)phenoxy]cyclohexyl]oxyethanone.
| Compound Name | 1-[4-(6-methoxy-3-pyridinyl)piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)phenoxy]cyclohexyl]oxyethanone |
|---|---|
| PubChem CID | 67282779 |
| Molecular Formula | C25H29F3N4O6 |
| Molecular Weight | 538.52 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | 1-[4-(6-methoxy-3-pyridinyl)piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)phenoxy]cyclohexyl]oxyethanone |
| SMILES | COc1ccc(N2CCN(C(=O)COC3CCC(Oc4ccc([N+](=O)[O-])c(C(F)(F)F)c4)CC3)CC2)cn1 |
| InChI | InChI=1S/C25H29F3N4O6/c1-36-23-9-2-17(15-29-23)30-10-12-31(13-11-30)24(33)16-37-18-3-5-19(6-4-18)38-20-7-8-22(32(34)35)21(14-20)25(26,27)28/h2,7-9,14-15,18-19H,3-6,10-13,16H2,1H3 |
| InChIKey | UCKOBKNEXABBLG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 107.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|