C32H36F3N3O5 — CID 154024852
1-[4-(6-hydroxynaphthalen-2-yl)piperazin-1-yl]-2-[4-[3-[4-nitro-3-(trifluoromethyl)phenyl]propyl]cyclohexyl]oxyethanone (PubChem CID 154024852) has the molecular formula C32H36F3N3O5 and a molecular weight of 599.65 g/mol. Its IUPAC name is 1-[4-(6-hydroxynaphthalen-2-yl)piperazin-1-yl]-2-[4-[3-[4-nitro-3-(trifluoromethyl)phenyl]propyl]cyclohexyl]oxyethanone.
| Compound Name | 1-[4-(6-hydroxynaphthalen-2-yl)piperazin-1-yl]-2-[4-[3-[4-nitro-3-(trifluoromethyl)phenyl]propyl]cyclohexyl]oxyethanone |
|---|---|
| PubChem CID | 154024852 |
| Molecular Formula | C32H36F3N3O5 |
| Molecular Weight | 599.65 g/mol |
| Exact Mass | 599.26 |
| IUPAC Name | 1-[4-(6-hydroxynaphthalen-2-yl)piperazin-1-yl]-2-[4-[3-[4-nitro-3-(trifluoromethyl)phenyl]propyl]cyclohexyl]oxyethanone |
| SMILES | O=C(COC1CCC(CCCc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)CC1)N1CCN(c2ccc3cc(O)ccc3c2)CC1 |
| InChI | InChI=1S/C32H36F3N3O5/c33-32(34,35)29-18-23(6-13-30(29)38(41)42)3-1-2-22-4-11-28(12-5-22)43-21-31(40)37-16-14-36(15-17-37)26-9-7-25-20-27(39)10-8-24(25)19-26/h6-10,13,18-20,22,28,39H,1-5,11-12,14-17,21H2 |
| InChIKey | NPYBAMXDHMRJHG-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 96.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.65 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|