C23H24F6N4O4 — CID 88984035
2-[3-[4-nitro-3-(trifluoromethyl)anilino]propoxy]-1-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone (PubChem CID 88984035) has the molecular formula C23H24F6N4O4 and a molecular weight of 534.46 g/mol. Its IUPAC name is 2-[3-[4-nitro-3-(trifluoromethyl)anilino]propoxy]-1-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone.
| Compound Name | 2-[3-[4-nitro-3-(trifluoromethyl)anilino]propoxy]-1-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 88984035 |
| Molecular Formula | C23H24F6N4O4 |
| Molecular Weight | 534.46 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | 2-[3-[4-nitro-3-(trifluoromethyl)anilino]propoxy]-1-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone |
| SMILES | O=C(COCCCNc1ccc([N+](=O)[O-])c(C(F)(F)F)c1)N1CCN(c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C23H24F6N4O4/c24-22(25,26)16-2-5-18(6-3-16)31-9-11-32(12-10-31)21(34)15-37-13-1-8-30-17-4-7-20(33(35)36)19(14-17)23(27,28)29/h2-7,14,30H,1,8-13,15H2 |
| InChIKey | RHPCAGWFMFAFLJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|