C28H35N5O4 — CID 58118091
2-methyl-4-[[4-[2-[4-(3-methyl-4-nitrophenyl)-1,4-diazepan-1-yl]-2-oxoethoxy]cyclohexyl]amino]benzonitrile (PubChem CID 58118091) has the molecular formula C28H35N5O4 and a molecular weight of 505.62 g/mol. Its IUPAC name is 2-methyl-4-[[4-[2-[4-(3-methyl-4-nitrophenyl)-1,4-diazepan-1-yl]-2-oxoethoxy]cyclohexyl]amino]benzonitrile.
| Compound Name | 2-methyl-4-[[4-[2-[4-(3-methyl-4-nitrophenyl)-1,4-diazepan-1-yl]-2-oxoethoxy]cyclohexyl]amino]benzonitrile |
|---|---|
| PubChem CID | 58118091 |
| Molecular Formula | C28H35N5O4 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | 2-methyl-4-[[4-[2-[4-(3-methyl-4-nitrophenyl)-1,4-diazepan-1-yl]-2-oxoethoxy]cyclohexyl]amino]benzonitrile |
| SMILES | Cc1cc(NC2CCC(OCC(=O)N3CCCN(c4ccc([N+](=O)[O-])c(C)c4)CC3)CC2)ccc1C#N |
| InChI | InChI=1S/C28H35N5O4/c1-20-16-24(5-4-22(20)18-29)30-23-6-9-26(10-7-23)37-19-28(34)32-13-3-12-31(14-15-32)25-8-11-27(33(35)36)21(2)17-25/h4-5,8,11,16-17,23,26,30H,3,6-7,9-10,12-15,19H2,1-2H3 |
| InChIKey | SNIJADJEHXNIFQ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 111.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|