C29H32F3N5O2 — CID 58118385
4-[[4-[2-[4-(4-isocyano-3-methylphenyl)-1,4-diazepan-1-yl]-2-oxoethoxy]cyclohexyl]amino]-2-(trifluoromethyl)benzonitrile (PubChem CID 58118385) has the molecular formula C29H32F3N5O2 and a molecular weight of 539.60 g/mol. Its IUPAC name is 4-[[4-[2-[4-(4-isocyano-3-methylphenyl)-1,4-diazepan-1-yl]-2-oxoethoxy]cyclohexyl]amino]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[[4-[2-[4-(4-isocyano-3-methylphenyl)-1,4-diazepan-1-yl]-2-oxoethoxy]cyclohexyl]amino]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 58118385 |
| Molecular Formula | C29H32F3N5O2 |
| Molecular Weight | 539.60 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | 4-[[4-[2-[4-(4-isocyano-3-methylphenyl)-1,4-diazepan-1-yl]-2-oxoethoxy]cyclohexyl]amino]-2-(trifluoromethyl)benzonitrile |
| SMILES | [C-]#[N+]c1ccc(N2CCCN(C(=O)COC3CCC(Nc4ccc(C#N)c(C(F)(F)F)c4)CC3)CC2)cc1C |
| InChI | InChI=1S/C29H32F3N5O2/c1-20-16-24(8-11-27(20)34-2)36-12-3-13-37(15-14-36)28(38)19-39-25-9-6-22(7-10-25)35-23-5-4-21(18-33)26(17-23)29(30,31)32/h4-5,8,11,16-17,22,25,35H,3,6-7,9-10,12-15,19H2,1H3 |
| InChIKey | JHNYAIVYRMUZOZ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.60 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|