C26H30FIN4O2 — CID 70804205
2-(fluoromethyl)-4-[[4-[2-[4-(4-iodophenyl)piperazin-1-yl]-2-oxoethoxy]cyclohexyl]amino]benzonitrile (PubChem CID 70804205) has the molecular formula C26H30FIN4O2 and a molecular weight of 576.45 g/mol. Its IUPAC name is 2-(fluoromethyl)-4-[[4-[2-[4-(4-iodophenyl)piperazin-1-yl]-2-oxoethoxy]cyclohexyl]amino]benzonitrile.
| Compound Name | 2-(fluoromethyl)-4-[[4-[2-[4-(4-iodophenyl)piperazin-1-yl]-2-oxoethoxy]cyclohexyl]amino]benzonitrile |
|---|---|
| PubChem CID | 70804205 |
| Molecular Formula | C26H30FIN4O2 |
| Molecular Weight | 576.45 g/mol |
| Exact Mass | 576.14 |
| IUPAC Name | 2-(fluoromethyl)-4-[[4-[2-[4-(4-iodophenyl)piperazin-1-yl]-2-oxoethoxy]cyclohexyl]amino]benzonitrile |
| SMILES | N#Cc1ccc(NC2CCC(OCC(=O)N3CCN(c4ccc(I)cc4)CC3)CC2)cc1CF |
| InChI | InChI=1S/C26H30FIN4O2/c27-16-20-15-23(4-1-19(20)17-29)30-22-5-9-25(10-6-22)34-18-26(33)32-13-11-31(12-14-32)24-7-2-21(28)3-8-24/h1-4,7-8,15,22,25,30H,5-6,9-14,16,18H2 |
| InChIKey | BKDLNSHXZXSHRC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|